C16H15N5O5 — CID 135814848
methyl 2-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-4-oxo-3H-quinazoline-7-carboxylate (PubChem CID 135814848) has the molecular formula C16H15N5O5 and a molecular weight of 357.33 g/mol. Its IUPAC name is methyl 2-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-4-oxo-3H-quinazoline-7-carboxylate.
| Compound Name | methyl 2-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-4-oxo-3H-quinazoline-7-carboxylate |
|---|---|
| PubChem CID | 135814848 |
| Molecular Formula | C16H15N5O5 |
| Molecular Weight | 357.33 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | methyl 2-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-4-oxo-3H-quinazoline-7-carboxylate |
| SMILES | COC(=O)c1ccc2c(=O)[nH]c(Cn3nc(C)c([N+](=O)[O-])c3C)nc2c1 |
| InChI | InChI=1S/C16H15N5O5/c1-8-14(21(24)25)9(2)20(19-8)7-13-17-12-6-10(16(23)26-3)4-5-11(12)15(22)18-13/h4-6H,7H2,1-3H3,(H,17,18,22) |
| InChIKey | VXJJLFZZYXXSHL-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 133.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.33 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|