C16H12Cl2N4OS — CID 135729696
(7-chloro-4-oxo-3H-quinazolin-2-yl)methyl N'-(4-chlorophenyl)carbamimidothioate (PubChem CID 135729696) has the molecular formula C16H12Cl2N4OS and a molecular weight of 379.27 g/mol. Its IUPAC name is (7-chloro-4-oxo-3H-quinazolin-2-yl)methyl N'-(4-chlorophenyl)carbamimidothioate.
| Compound Name | (7-chloro-4-oxo-3H-quinazolin-2-yl)methyl N'-(4-chlorophenyl)carbamimidothioate |
|---|---|
| PubChem CID | 135729696 |
| Molecular Formula | C16H12Cl2N4OS |
| Molecular Weight | 379.27 g/mol |
| Exact Mass | 378.01 |
| IUPAC Name | (7-chloro-4-oxo-3H-quinazolin-2-yl)methyl N'-(4-chlorophenyl)carbamimidothioate |
| SMILES | N/C(=N\c1ccc(Cl)cc1)SCc1nc2cc(Cl)ccc2c(=O)[nH]1 |
| InChI | InChI=1S/C16H12Cl2N4OS/c17-9-1-4-11(5-2-9)20-16(19)24-8-14-21-13-7-10(18)3-6-12(13)15(23)22-14/h1-7H,8H2,(H2,19,20)(H,21,22,23) |
| InChIKey | LAATUPGVVKCJRB-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 84.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.27 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|