C16H10Cl2N6OS — CID 135751289
7-chloro-2-[[1-(3-chlorophenyl)tetrazol-5-yl]sulfanylmethyl]-3H-quinazolin-4-one (PubChem CID 135751289) has the molecular formula C16H10Cl2N6OS and a molecular weight of 405.27 g/mol. Its IUPAC name is 7-chloro-2-[[1-(3-chlorophenyl)tetrazol-5-yl]sulfanylmethyl]-3H-quinazolin-4-one.
| Compound Name | 7-chloro-2-[[1-(3-chlorophenyl)tetrazol-5-yl]sulfanylmethyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135751289 |
| Molecular Formula | C16H10Cl2N6OS |
| Molecular Weight | 405.27 g/mol |
| Exact Mass | 404.00 |
| IUPAC Name | 7-chloro-2-[[1-(3-chlorophenyl)tetrazol-5-yl]sulfanylmethyl]-3H-quinazolin-4-one |
| SMILES | O=c1[nH]c(CSc2nnnn2-c2cccc(Cl)c2)nc2cc(Cl)ccc12 |
| InChI | InChI=1S/C16H10Cl2N6OS/c17-9-2-1-3-11(6-9)24-16(21-22-23-24)26-8-14-19-13-7-10(18)4-5-12(13)15(25)20-14/h1-7H,8H2,(H,19,20,25) |
| InChIKey | PWGNYUDMHHVDPJ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.27 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |