C18H19N3O3 — CID 137264237
2-[(4-ethoxy-3-methoxyphenyl)methylamino]-3H-quinazolin-4-one (PubChem CID 137264237) has the molecular formula C18H19N3O3 and a molecular weight of 325.37 g/mol. Its IUPAC name is 2-[(4-ethoxy-3-methoxyphenyl)methylamino]-3H-quinazolin-4-one.
| Compound Name | 2-[(4-ethoxy-3-methoxyphenyl)methylamino]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 137264237 |
| Molecular Formula | C18H19N3O3 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | 2-[(4-ethoxy-3-methoxyphenyl)methylamino]-3H-quinazolin-4-one |
| SMILES | CCOc1ccc(CNc2nc3ccccc3c(=O)[nH]2)cc1OC |
| InChI | InChI=1S/C18H19N3O3/c1-3-24-15-9-8-12(10-16(15)23-2)11-19-18-20-14-7-5-4-6-13(14)17(22)21-18/h4-10H,3,11H2,1-2H3,(H2,19,20,21,22) |
| InChIKey | WQBLNECDNJMSEG-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |