C15H16F3N3O3 — CID 136741427
2-[(3-ethoxy-4-methoxyphenyl)methylamino]-4-(trifluoromethyl)-1H-pyrimidin-6-one (PubChem CID 136741427) has the molecular formula C15H16F3N3O3 and a molecular weight of 343.31 g/mol. Its IUPAC name is 2-[(3-ethoxy-4-methoxyphenyl)methylamino]-4-(trifluoromethyl)-1H-pyrimidin-6-one.
| Compound Name | 2-[(3-ethoxy-4-methoxyphenyl)methylamino]-4-(trifluoromethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136741427 |
| Molecular Formula | C15H16F3N3O3 |
| Molecular Weight | 343.31 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | 2-[(3-ethoxy-4-methoxyphenyl)methylamino]-4-(trifluoromethyl)-1H-pyrimidin-6-one |
| SMILES | CCOc1cc(CNc2nc(C(F)(F)F)cc(=O)[nH]2)ccc1OC |
| InChI | InChI=1S/C15H16F3N3O3/c1-3-24-11-6-9(4-5-10(11)23-2)8-19-14-20-12(15(16,17)18)7-13(22)21-14/h4-7H,3,8H2,1-2H3,(H2,19,20,21,22) |
| InChIKey | BBIZKGCVOFXJFP-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.31 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |