C16H24N4O2 — CID 21002974
N-(6,7-dimethoxyquinazolin-4-yl)-N',N'-diethylethane-1,2-diamine (PubChem CID 21002974) has the molecular formula C16H24N4O2 and a molecular weight of 304.39 g/mol. Its IUPAC name is N-(6,7-dimethoxyquinazolin-4-yl)-N',N'-diethylethane-1,2-diamine.
| Compound Name | N-(6,7-dimethoxyquinazolin-4-yl)-N',N'-diethylethane-1,2-diamine |
|---|---|
| PubChem CID | 21002974 |
| Molecular Formula | C16H24N4O2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | N-(6,7-dimethoxyquinazolin-4-yl)-N',N'-diethylethane-1,2-diamine |
| SMILES | CCN(CC)CCNc1ncnc2cc(OC)c(OC)cc12 |
| InChI | InChI=1S/C16H24N4O2/c1-5-20(6-2)8-7-17-16-12-9-14(21-3)15(22-4)10-13(12)18-11-19-16/h9-11H,5-8H2,1-4H3,(H,17,18,19) |
| InChIKey | HRDICVBQQBGHTP-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |