C12H16N3O2P — CID 59068661
7-methoxy-4-(3-phosphanylpropylamino)quinazolin-6-ol (PubChem CID 59068661) has the molecular formula C12H16N3O2P and a molecular weight of 265.25 g/mol. Its IUPAC name is 7-methoxy-4-(3-phosphanylpropylamino)quinazolin-6-ol.
| Compound Name | 7-methoxy-4-(3-phosphanylpropylamino)quinazolin-6-ol |
|---|---|
| PubChem CID | 59068661 |
| Molecular Formula | C12H16N3O2P |
| Molecular Weight | 265.25 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | 7-methoxy-4-(3-phosphanylpropylamino)quinazolin-6-ol |
| SMILES | COc1cc2ncnc(NCCCP)c2cc1O |
| InChI | InChI=1S/C12H16N3O2P/c1-17-11-6-9-8(5-10(11)16)12(15-7-14-9)13-3-2-4-18/h5-7,16H,2-4,18H2,1H3,(H,13,14,15) |
| InChIKey | CJALQNWMKOPLQW-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.25 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|