C11H15AcN3O7P2 — CID 58735298
actinium;[hydroxy-[[(6-hydroxy-7-methoxyquinazolin-4-yl)amino]methyl]phosphoryl]methylphosphonic acid (PubChem CID 58735298) has the molecular formula C11H15AcN3O7P2 and a molecular weight of 590.20 g/mol. Its IUPAC name is actinium;[hydroxy-[[(6-hydroxy-7-methoxyquinazolin-4-yl)amino]methyl]phosphoryl]methylphosphonic acid.
| Compound Name | actinium;[hydroxy-[[(6-hydroxy-7-methoxyquinazolin-4-yl)amino]methyl]phosphoryl]methylphosphonic acid |
|---|---|
| PubChem CID | 58735298 |
| Molecular Formula | C11H15AcN3O7P2 |
| Molecular Weight | 590.20 g/mol |
| Exact Mass | 590.07 |
| IUPAC Name | actinium;[hydroxy-[[(6-hydroxy-7-methoxyquinazolin-4-yl)amino]methyl]phosphoryl]methylphosphonic acid |
| SMILES | COc1cc2ncnc(NCP(=O)(O)CP(=O)(O)O)c2cc1O.[Ac] |
| InChI | InChI=1S/C11H15N3O7P2.Ac/c1-21-10-3-8-7(2-9(10)15)11(13-4-12-8)14-5-22(16,17)6-23(18,19)20;/h2-4,15H,5-6H2,1H3,(H,16,17)(H,12,13,14)(H2,18,19,20); |
| InChIKey | KXFVEUVSMSVRQC-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 162.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.20 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|