C16H14FN3O3 — CID 135549384
4-(2-fluoro-5-hydroxy-4-methylanilino)-6-methoxyquinazolin-7-ol (PubChem CID 135549384) has the molecular formula C16H14FN3O3 and a molecular weight of 315.30 g/mol. Its IUPAC name is 4-(2-fluoro-5-hydroxy-4-methylanilino)-6-methoxyquinazolin-7-ol.
| Compound Name | 4-(2-fluoro-5-hydroxy-4-methylanilino)-6-methoxyquinazolin-7-ol |
|---|---|
| PubChem CID | 135549384 |
| Molecular Formula | C16H14FN3O3 |
| Molecular Weight | 315.30 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | 4-(2-fluoro-5-hydroxy-4-methylanilino)-6-methoxyquinazolin-7-ol |
| SMILES | COc1cc2c(Nc3cc(O)c(C)cc3F)ncnc2cc1O |
| InChI | InChI=1S/C16H14FN3O3/c1-8-3-10(17)12(6-13(8)21)20-16-9-4-15(23-2)14(22)5-11(9)18-7-19-16/h3-7,21-22H,1-2H3,(H,18,19,20) |
| InChIKey | NJCMKUCCNAOJPS-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 87.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.30 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |