C18H14FN3O2 — CID 22646515
4-(2-fluoro-5-hydroxy-4-methylanilino)-7-methoxyquinoline-6-carbonitrile (PubChem CID 22646515) has the molecular formula C18H14FN3O2 and a molecular weight of 323.33 g/mol. Its IUPAC name is 4-(2-fluoro-5-hydroxy-4-methylanilino)-7-methoxyquinoline-6-carbonitrile.
| Compound Name | 4-(2-fluoro-5-hydroxy-4-methylanilino)-7-methoxyquinoline-6-carbonitrile |
|---|---|
| PubChem CID | 22646515 |
| Molecular Formula | C18H14FN3O2 |
| Molecular Weight | 323.33 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | 4-(2-fluoro-5-hydroxy-4-methylanilino)-7-methoxyquinoline-6-carbonitrile |
| SMILES | COc1cc2nccc(Nc3cc(O)c(C)cc3F)c2cc1C#N |
| InChI | InChI=1S/C18H14FN3O2/c1-10-5-13(19)16(7-17(10)23)22-14-3-4-21-15-8-18(24-2)11(9-20)6-12(14)15/h3-8,23H,1-2H3,(H,21,22) |
| InChIKey | GNFLQOZYHWBHGM-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 78.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.33 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |