C24H29ClFN3O3 — CID 22646610
1-azabicyclo[2.1.0]pentane;4-fluoro-5-[(6-methoxy-7-propoxyquinolin-4-yl)amino]-2-methylphenol;hydrochloride (PubChem CID 22646610) has the molecular formula C24H29ClFN3O3 and a molecular weight of 461.97 g/mol. Its IUPAC name is 1-azabicyclo[2.1.0]pentane;4-fluoro-5-[(6-methoxy-7-propoxyquinolin-4-yl)amino]-2-methylphenol;hydrochloride.
| Compound Name | 1-azabicyclo[2.1.0]pentane;4-fluoro-5-[(6-methoxy-7-propoxyquinolin-4-yl)amino]-2-methylphenol;hydrochloride |
|---|---|
| PubChem CID | 22646610 |
| Molecular Formula | C24H29ClFN3O3 |
| Molecular Weight | 461.97 g/mol |
| Exact Mass | 461.19 |
| IUPAC Name | 1-azabicyclo[2.1.0]pentane;4-fluoro-5-[(6-methoxy-7-propoxyquinolin-4-yl)amino]-2-methylphenol;hydrochloride |
| SMILES | C1CN2CC12.CCCOc1cc2nccc(Nc3cc(O)c(C)cc3F)c2cc1OC.Cl |
| InChI | InChI=1S/C20H21FN2O3.C4H7N.ClH/c1-4-7-26-20-11-16-13(9-19(20)25-3)15(5-6-22-16)23-17-10-18(24)12(2)8-14(17)21;1-2-5-3-4(1)5;/h5-6,8-11,24H,4,7H2,1-3H3,(H,22,23);4H,1-3H2;1H |
| InChIKey | VCRYILGYRAFQPA-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 66.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.97 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|