C27H38N6O2 — CID 168926826
4-N-[1-(butylamino)ethenyl]-1-N-[7-[2-(diethylamino)ethoxy]-6-methoxyquinazolin-4-yl]benzene-1,4-diamine (PubChem CID 168926826) has the molecular formula C27H38N6O2 and a molecular weight of 478.64 g/mol. Its IUPAC name is 4-N-[1-(butylamino)ethenyl]-1-N-[7-[2-(diethylamino)ethoxy]-6-methoxyquinazolin-4-yl]benzene-1,4-diamine.
| Compound Name | 4-N-[1-(butylamino)ethenyl]-1-N-[7-[2-(diethylamino)ethoxy]-6-methoxyquinazolin-4-yl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 168926826 |
| Molecular Formula | C27H38N6O2 |
| Molecular Weight | 478.64 g/mol |
| Exact Mass | 478.31 |
| IUPAC Name | 4-N-[1-(butylamino)ethenyl]-1-N-[7-[2-(diethylamino)ethoxy]-6-methoxyquinazolin-4-yl]benzene-1,4-diamine |
| SMILES | C=C(NCCCC)Nc1ccc(Nc2ncnc3cc(OCCN(CC)CC)c(OC)cc23)cc1 |
| InChI | InChI=1S/C27H38N6O2/c1-6-9-14-28-20(4)31-21-10-12-22(13-11-21)32-27-23-17-25(34-5)26(18-24(23)29-19-30-27)35-16-15-33(7-2)8-3/h10-13,17-19,28,31H,4,6-9,14-16H2,1-3,5H3,(H,29,30,32) |
| InChIKey | WHKDTFYWOGKFLC-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 83.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.64 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|