C29H32FN5O3 — CID 91368379
7-[3-(dimethylamino)propoxy]-N-[4-[1-[(4-fluorophenyl)methoxyamino]ethenyl]phenyl]-6-methoxyquinazolin-4-amine (PubChem CID 91368379) has the molecular formula C29H32FN5O3 and a molecular weight of 517.61 g/mol. Its IUPAC name is 7-[3-(dimethylamino)propoxy]-N-[4-[1-[(4-fluorophenyl)methoxyamino]ethenyl]phenyl]-6-methoxyquinazolin-4-amine.
| Compound Name | 7-[3-(dimethylamino)propoxy]-N-[4-[1-[(4-fluorophenyl)methoxyamino]ethenyl]phenyl]-6-methoxyquinazolin-4-amine |
|---|---|
| PubChem CID | 91368379 |
| Molecular Formula | C29H32FN5O3 |
| Molecular Weight | 517.61 g/mol |
| Exact Mass | 517.25 |
| IUPAC Name | 7-[3-(dimethylamino)propoxy]-N-[4-[1-[(4-fluorophenyl)methoxyamino]ethenyl]phenyl]-6-methoxyquinazolin-4-amine |
| SMILES | C=C(NOCc1ccc(F)cc1)c1ccc(Nc2ncnc3cc(OCCCN(C)C)c(OC)cc23)cc1 |
| InChI | InChI=1S/C29H32FN5O3/c1-20(34-38-18-21-6-10-23(30)11-7-21)22-8-12-24(13-9-22)33-29-25-16-27(36-4)28(17-26(25)31-19-32-29)37-15-5-14-35(2)3/h6-13,16-17,19,34H,1,5,14-15,18H2,2-4H3,(H,31,32,33) |
| InChIKey | WZOBBFGSZATNBX-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 80.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.61 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|