C18H19FN4O2 — CID 67300948
7-butoxy-N-(4-fluorophenyl)-6-methoxy-1,2,3-benzotriazin-4-amine (PubChem CID 67300948) has the molecular formula C18H19FN4O2 and a molecular weight of 342.37 g/mol. Its IUPAC name is 7-butoxy-N-(4-fluorophenyl)-6-methoxy-1,2,3-benzotriazin-4-amine.
| Compound Name | 7-butoxy-N-(4-fluorophenyl)-6-methoxy-1,2,3-benzotriazin-4-amine |
|---|---|
| PubChem CID | 67300948 |
| Molecular Formula | C18H19FN4O2 |
| Molecular Weight | 342.37 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | 7-butoxy-N-(4-fluorophenyl)-6-methoxy-1,2,3-benzotriazin-4-amine |
| SMILES | CCCCOc1cc2nnnc(Nc3ccc(F)cc3)c2cc1OC |
| InChI | InChI=1S/C18H19FN4O2/c1-3-4-9-25-17-11-15-14(10-16(17)24-2)18(22-23-21-15)20-13-7-5-12(19)6-8-13/h5-8,10-11H,3-4,9H2,1-2H3,(H,20,21,22) |
| InChIKey | BZYLSMGBCGBCAM-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.37 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|