C18H19ClN4O2 — CID 67301092
7-(1-chloropropoxy)-6-methoxy-N-(4-methylphenyl)-1,2,3-benzotriazin-4-amine (PubChem CID 67301092) has the molecular formula C18H19ClN4O2 and a molecular weight of 358.83 g/mol. Its IUPAC name is 7-(1-chloropropoxy)-6-methoxy-N-(4-methylphenyl)-1,2,3-benzotriazin-4-amine.
| Compound Name | 7-(1-chloropropoxy)-6-methoxy-N-(4-methylphenyl)-1,2,3-benzotriazin-4-amine |
|---|---|
| PubChem CID | 67301092 |
| Molecular Formula | C18H19ClN4O2 |
| Molecular Weight | 358.83 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | 7-(1-chloropropoxy)-6-methoxy-N-(4-methylphenyl)-1,2,3-benzotriazin-4-amine |
| SMILES | CCC(Cl)Oc1cc2nnnc(Nc3ccc(C)cc3)c2cc1OC |
| InChI | InChI=1S/C18H19ClN4O2/c1-4-17(19)25-16-10-14-13(9-15(16)24-3)18(22-23-21-14)20-12-7-5-11(2)6-8-12/h5-10,17H,4H2,1-3H3,(H,20,21,22) |
| InChIKey | JQMYRSLNYSODRA-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.83 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|