C17H15ClF2N4O2 — CID 67301345
7-(3-chloropropoxy)-N-(3,5-difluorophenyl)-6-methoxy-1,2,3-benzotriazin-4-amine (PubChem CID 67301345) has the molecular formula C17H15ClF2N4O2 and a molecular weight of 380.78 g/mol. Its IUPAC name is 7-(3-chloropropoxy)-N-(3,5-difluorophenyl)-6-methoxy-1,2,3-benzotriazin-4-amine.
| Compound Name | 7-(3-chloropropoxy)-N-(3,5-difluorophenyl)-6-methoxy-1,2,3-benzotriazin-4-amine |
|---|---|
| PubChem CID | 67301345 |
| Molecular Formula | C17H15ClF2N4O2 |
| Molecular Weight | 380.78 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | 7-(3-chloropropoxy)-N-(3,5-difluorophenyl)-6-methoxy-1,2,3-benzotriazin-4-amine |
| SMILES | COc1cc2c(Nc3cc(F)cc(F)c3)nnnc2cc1OCCCCl |
| InChI | InChI=1S/C17H15ClF2N4O2/c1-25-15-8-13-14(9-16(15)26-4-2-3-18)22-24-23-17(13)21-12-6-10(19)5-11(20)7-12/h5-9H,2-4H2,1H3,(H,21,22,23) |
| InChIKey | PMLBSPMZAIUGDX-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.78 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|