C17H15BrClFN4O2 — CID 67301405
N-(4-bromo-3-fluorophenyl)-7-(1-chloropropoxy)-6-methoxy-1,2,3-benzotriazin-4-amine (PubChem CID 67301405) has the molecular formula C17H15BrClFN4O2 and a molecular weight of 441.69 g/mol. Its IUPAC name is N-(4-bromo-3-fluorophenyl)-7-(1-chloropropoxy)-6-methoxy-1,2,3-benzotriazin-4-amine.
| Compound Name | N-(4-bromo-3-fluorophenyl)-7-(1-chloropropoxy)-6-methoxy-1,2,3-benzotriazin-4-amine |
|---|---|
| PubChem CID | 67301405 |
| Molecular Formula | C17H15BrClFN4O2 |
| Molecular Weight | 441.69 g/mol |
| Exact Mass | 440.01 |
| IUPAC Name | N-(4-bromo-3-fluorophenyl)-7-(1-chloropropoxy)-6-methoxy-1,2,3-benzotriazin-4-amine |
| SMILES | CCC(Cl)Oc1cc2nnnc(Nc3ccc(Br)c(F)c3)c2cc1OC |
| InChI | InChI=1S/C17H15BrClFN4O2/c1-3-16(19)26-15-8-13-10(7-14(15)25-2)17(23-24-22-13)21-9-4-5-11(18)12(20)6-9/h4-8,16H,3H2,1-2H3,(H,21,22,23) |
| InChIKey | HINDHTYHTMODQA-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.69 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|