C23H27ClF3N5O3 — CID 67300974
6-methoxy-7-(3-piperidin-1-ylpropoxy)-N-[3-(trifluoromethoxy)phenyl]-1,2,3-benzotriazin-4-amine;hydrochloride (PubChem CID 67300974) has the molecular formula C23H27ClF3N5O3 and a molecular weight of 513.95 g/mol. Its IUPAC name is 6-methoxy-7-(3-piperidin-1-ylpropoxy)-N-[3-(trifluoromethoxy)phenyl]-1,2,3-benzotriazin-4-amine;hydrochloride.
| Compound Name | 6-methoxy-7-(3-piperidin-1-ylpropoxy)-N-[3-(trifluoromethoxy)phenyl]-1,2,3-benzotriazin-4-amine;hydrochloride |
|---|---|
| PubChem CID | 67300974 |
| Molecular Formula | C23H27ClF3N5O3 |
| Molecular Weight | 513.95 g/mol |
| Exact Mass | 513.18 |
| IUPAC Name | 6-methoxy-7-(3-piperidin-1-ylpropoxy)-N-[3-(trifluoromethoxy)phenyl]-1,2,3-benzotriazin-4-amine;hydrochloride |
| SMILES | COc1cc2c(Nc3cccc(OC(F)(F)F)c3)nnnc2cc1OCCCN1CCCCC1.Cl |
| InChI | InChI=1S/C23H26F3N5O3.ClH/c1-32-20-14-18-19(15-21(20)33-12-6-11-31-9-3-2-4-10-31)28-30-29-22(18)27-16-7-5-8-17(13-16)34-23(24,25)26;/h5,7-8,13-15H,2-4,6,9-12H2,1H3,(H,27,28,29);1H |
| InChIKey | VRLQXJDQYKSKMQ-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 81.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.95 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|