C20H22ClN3O2 — CID 22693257
N-(4-tert-butylphenyl)-2-chloro-6,7-dimethoxyquinazolin-4-amine (PubChem CID 22693257) has the molecular formula C20H22ClN3O2 and a molecular weight of 371.87 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-2-chloro-6,7-dimethoxyquinazolin-4-amine.
| Compound Name | N-(4-tert-butylphenyl)-2-chloro-6,7-dimethoxyquinazolin-4-amine |
|---|---|
| PubChem CID | 22693257 |
| Molecular Formula | C20H22ClN3O2 |
| Molecular Weight | 371.87 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | N-(4-tert-butylphenyl)-2-chloro-6,7-dimethoxyquinazolin-4-amine |
| SMILES | COc1cc2nc(Cl)nc(Nc3ccc(C(C)(C)C)cc3)c2cc1OC |
| InChI | InChI=1S/C20H22ClN3O2/c1-20(2,3)12-6-8-13(9-7-12)22-18-14-10-16(25-4)17(26-5)11-15(14)23-19(21)24-18/h6-11H,1-5H3,(H,22,23,24) |
| InChIKey | XPPYUGCNODFDJD-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.87 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |