C19H21N3O2 — CID 68916243
6,7-dimethoxy-N-(2-propylphenyl)quinazolin-4-amine (PubChem CID 68916243) has the molecular formula C19H21N3O2 and a molecular weight of 323.40 g/mol. Its IUPAC name is 6,7-dimethoxy-N-(2-propylphenyl)quinazolin-4-amine.
| Compound Name | 6,7-dimethoxy-N-(2-propylphenyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 68916243 |
| Molecular Formula | C19H21N3O2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | 6,7-dimethoxy-N-(2-propylphenyl)quinazolin-4-amine |
| SMILES | CCCc1ccccc1Nc1ncnc2cc(OC)c(OC)cc12 |
| InChI | InChI=1S/C19H21N3O2/c1-4-7-13-8-5-6-9-15(13)22-19-14-10-17(23-2)18(24-3)11-16(14)20-12-21-19/h5-6,8-12H,4,7H2,1-3H3,(H,20,21,22) |
| InChIKey | XLFLUZDWVXIFQB-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |