C14H16N2O5 — CID 171600544
7-(4-hydroxy-3-oxobutoxy)-6-methoxy-2-methyl-3H-quinazolin-4-one (PubChem CID 171600544) has the molecular formula C14H16N2O5 and a molecular weight of 292.29 g/mol. Its IUPAC name is 7-(4-hydroxy-3-oxobutoxy)-6-methoxy-2-methyl-3H-quinazolin-4-one.
| Compound Name | 7-(4-hydroxy-3-oxobutoxy)-6-methoxy-2-methyl-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 171600544 |
| Molecular Formula | C14H16N2O5 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 7-(4-hydroxy-3-oxobutoxy)-6-methoxy-2-methyl-3H-quinazolin-4-one |
| SMILES | COc1cc2c(=O)[nH]c(C)nc2cc1OCCC(=O)CO |
| InChI | InChI=1S/C14H16N2O5/c1-8-15-11-6-13(21-4-3-9(18)7-17)12(20-2)5-10(11)14(19)16-8/h5-6,17H,3-4,7H2,1-2H3,(H,15,16,19) |
| InChIKey | ODDNKQNRSJBDNU-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 101.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |