C13H8N4O2S2 — CID 143172141
13-methyl-11-thiophen-2-yl-8-thia-3,5,10,12-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraene-4,6-dione (PubChem CID 143172141) has the molecular formula C13H8N4O2S2 and a molecular weight of 316.37 g/mol. Its IUPAC name is 13-methyl-11-thiophen-2-yl-8-thia-3,5,10,12-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraene-4,6-dione.
| Compound Name | 13-methyl-11-thiophen-2-yl-8-thia-3,5,10,12-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraene-4,6-dione |
|---|---|
| PubChem CID | 143172141 |
| Molecular Formula | C13H8N4O2S2 |
| Molecular Weight | 316.37 g/mol |
| Exact Mass | 316.01 |
| IUPAC Name | 13-methyl-11-thiophen-2-yl-8-thia-3,5,10,12-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraene-4,6-dione |
| SMILES | Cc1nc(-c2cccs2)nc2sc3c(=O)[nH]c(=O)[nH]c3c12 |
| InChI | InChI=1S/C13H8N4O2S2/c1-5-7-8-9(11(18)17-13(19)15-8)21-12(7)16-10(14-5)6-3-2-4-20-6/h2-4H,1H3,(H2,15,17,18,19) |
| InChIKey | XDGPXWXCGSSONS-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.37 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |