C11H9BrN4OS — CID 137274070
5-[(4-bromophenyl)diazenyl]-6-methyl-2-sulfanylidene-1H-pyrimidin-4-one (PubChem CID 137274070) has the molecular formula C11H9BrN4OS and a molecular weight of 325.19 g/mol. Its IUPAC name is 5-[(4-bromophenyl)diazenyl]-6-methyl-2-sulfanylidene-1H-pyrimidin-4-one.
| Compound Name | 5-[(4-bromophenyl)diazenyl]-6-methyl-2-sulfanylidene-1H-pyrimidin-4-one |
|---|---|
| PubChem CID | 137274070 |
| Molecular Formula | C11H9BrN4OS |
| Molecular Weight | 325.19 g/mol |
| Exact Mass | 323.97 |
| IUPAC Name | 5-[(4-bromophenyl)diazenyl]-6-methyl-2-sulfanylidene-1H-pyrimidin-4-one |
| SMILES | Cc1[nH]c(=S)[nH]c(=O)c1/N=N/c1ccc(Br)cc1 |
| InChI | InChI=1S/C11H9BrN4OS/c1-6-9(10(17)14-11(18)13-6)16-15-8-4-2-7(12)3-5-8/h2-5H,1H3,(H2,13,14,17,18)/b16-15+ |
| InChIKey | FVDJYKHJCXAJHI-FOCLMDBBSA-N |
| XLogP | 3.92 |
| TPSA | 73.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.19 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|