C12H10N4O4S — CID 939169
methyl 4-[(6-hydroxy-4-oxo-2-sulfanylidene-1H-pyrimidin-5-yl)diazenyl]benzoate (PubChem CID 939169) has the molecular formula C12H10N4O4S and a molecular weight of 306.30 g/mol. Its IUPAC name is methyl 4-[(6-hydroxy-4-oxo-2-sulfanylidene-1H-pyrimidin-5-yl)diazenyl]benzoate.
| Compound Name | methyl 4-[(6-hydroxy-4-oxo-2-sulfanylidene-1H-pyrimidin-5-yl)diazenyl]benzoate |
|---|---|
| PubChem CID | 939169 |
| Molecular Formula | C12H10N4O4S |
| Molecular Weight | 306.30 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | methyl 4-[(6-hydroxy-4-oxo-2-sulfanylidene-1H-pyrimidin-5-yl)diazenyl]benzoate |
| SMILES | COC(=O)c1ccc(/N=N/c2c(O)[nH]c(=S)[nH]c2=O)cc1 |
| InChI | InChI=1S/C12H10N4O4S/c1-20-11(19)6-2-4-7(5-3-6)15-16-8-9(17)13-12(21)14-10(8)18/h2-5H,1H3,(H3,13,14,17,18,21)/b16-15+ |
| InChIKey | UUQAYUFCIMJHPS-FOCLMDBBSA-N |
| XLogP | 2.34 |
| TPSA | 119.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.30 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|