C21H20N8O2 — CID 135406161
5-methyl-4-[[4-[[4-[(3-methyl-5-oxo-1,2-dihydropyrazol-4-yl)diazenyl]phenyl]methyl]phenyl]diazenyl]-1,2-dihydropyrazol-3-one (PubChem CID 135406161) has the molecular formula C21H20N8O2 and a molecular weight of 416.45 g/mol. Its IUPAC name is 5-methyl-4-[[4-[[4-[(3-methyl-5-oxo-1,2-dihydropyrazol-4-yl)diazenyl]phenyl]methyl]phenyl]diazenyl]-1,2-dihydropyrazol-3-one.
| Compound Name | 5-methyl-4-[[4-[[4-[(3-methyl-5-oxo-1,2-dihydropyrazol-4-yl)diazenyl]phenyl]methyl]phenyl]diazenyl]-1,2-dihydropyrazol-3-one |
|---|---|
| PubChem CID | 135406161 |
| Molecular Formula | C21H20N8O2 |
| Molecular Weight | 416.45 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | 5-methyl-4-[[4-[[4-[(3-methyl-5-oxo-1,2-dihydropyrazol-4-yl)diazenyl]phenyl]methyl]phenyl]diazenyl]-1,2-dihydropyrazol-3-one |
| SMILES | Cc1[nH][nH]c(=O)c1/N=N/c1ccc(Cc2ccc(/N=N/c3c(C)[nH][nH]c3=O)cc2)cc1 |
| InChI | InChI=1S/C21H20N8O2/c1-12-18(20(30)28-22-12)26-24-16-7-3-14(4-8-16)11-15-5-9-17(10-6-15)25-27-19-13(2)23-29-21(19)31/h3-10H,11H2,1-2H3,(H2,22,28,30)(H2,23,29,31)/b26-24+,27-25+ |
| InChIKey | NMTWRVNKZBYJIV-OWUYFMIJSA-N |
| XLogP | 4.76 |
| TPSA | 146.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.45 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|