C12H13N5O2 — CID 137199518
6-amino-5-[(4-ethylphenyl)diazenyl]-1H-pyrimidine-2,4-dione (PubChem CID 137199518) has the molecular formula C12H13N5O2 and a molecular weight of 259.27 g/mol. Its IUPAC name is 6-amino-5-[(4-ethylphenyl)diazenyl]-1H-pyrimidine-2,4-dione.
| Compound Name | 6-amino-5-[(4-ethylphenyl)diazenyl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 137199518 |
| Molecular Formula | C12H13N5O2 |
| Molecular Weight | 259.27 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | 6-amino-5-[(4-ethylphenyl)diazenyl]-1H-pyrimidine-2,4-dione |
| SMILES | CCc1ccc(/N=N/c2c(N)[nH]c(=O)[nH]c2=O)cc1 |
| InChI | InChI=1S/C12H13N5O2/c1-2-7-3-5-8(6-4-7)16-17-9-10(13)14-12(19)15-11(9)18/h3-6H,2H2,1H3,(H4,13,14,15,18,19)/b17-16+ |
| InChIKey | FYEJZRLKVQRMSX-WUKNDPDISA-N |
| XLogP | 1.62 |
| TPSA | 116.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.27 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|