C12H12N4O3 — CID 135997650
5-[(3,4-dimethylphenyl)diazenyl]-6-hydroxy-1H-pyrimidine-2,4-dione (PubChem CID 135997650) has the molecular formula C12H12N4O3 and a molecular weight of 260.25 g/mol. Its IUPAC name is 5-[(3,4-dimethylphenyl)diazenyl]-6-hydroxy-1H-pyrimidine-2,4-dione.
| Compound Name | 5-[(3,4-dimethylphenyl)diazenyl]-6-hydroxy-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 135997650 |
| Molecular Formula | C12H12N4O3 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | 5-[(3,4-dimethylphenyl)diazenyl]-6-hydroxy-1H-pyrimidine-2,4-dione |
| SMILES | Cc1ccc(/N=N/c2c(O)[nH]c(=O)[nH]c2=O)cc1C |
| InChI | InChI=1S/C12H12N4O3/c1-6-3-4-8(5-7(6)2)15-16-9-10(17)13-12(19)14-11(9)18/h3-5H,1-2H3,(H3,13,14,17,18,19)/b16-15+ |
| InChIKey | YISBDELCCKBULG-FOCLMDBBSA-N |
| XLogP | 1.80 |
| TPSA | 110.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|