C19H18N2O — CID 135597429
1-[(3,4-dimethylphenyl)diazenyl]-3-methylnaphthalen-2-ol (PubChem CID 135597429) has the molecular formula C19H18N2O and a molecular weight of 290.37 g/mol. Its IUPAC name is 1-[(3,4-dimethylphenyl)diazenyl]-3-methylnaphthalen-2-ol.
| Compound Name | 1-[(3,4-dimethylphenyl)diazenyl]-3-methylnaphthalen-2-ol |
|---|---|
| PubChem CID | 135597429 |
| Molecular Formula | C19H18N2O |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | 1-[(3,4-dimethylphenyl)diazenyl]-3-methylnaphthalen-2-ol |
| SMILES | Cc1ccc(/N=N/c2c(O)c(C)cc3ccccc23)cc1C |
| InChI | InChI=1S/C19H18N2O/c1-12-8-9-16(11-13(12)2)20-21-18-17-7-5-4-6-15(17)10-14(3)19(18)22/h4-11,22H,1-3H3/b21-20+ |
| InChIKey | OXFXSELOMHLHJG-QZQOTICOSA-N |
| XLogP | 5.89 |
| TPSA | 44.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|