C34H28N6O6S2 — CID 153382256
4-amino-3-[[4-[4-[(1-amino-3-sulfonaphthalen-2-yl)diazenyl]-2-methylphenyl]-3-methylphenyl]diazenyl]naphthalene-2-sulfonic acid (PubChem CID 153382256) has the molecular formula C34H28N6O6S2 and a molecular weight of 680.77 g/mol. Its IUPAC name is 4-amino-3-[[4-[4-[(1-amino-3-sulfonaphthalen-2-yl)diazenyl]-2-methylphenyl]-3-methylphenyl]diazenyl]naphthalene-2-sulfonic acid.
| Compound Name | 4-amino-3-[[4-[4-[(1-amino-3-sulfonaphthalen-2-yl)diazenyl]-2-methylphenyl]-3-methylphenyl]diazenyl]naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 153382256 |
| Molecular Formula | C34H28N6O6S2 |
| Molecular Weight | 680.77 g/mol |
| Exact Mass | 680.15 |
| IUPAC Name | 4-amino-3-[[4-[4-[(1-amino-3-sulfonaphthalen-2-yl)diazenyl]-2-methylphenyl]-3-methylphenyl]diazenyl]naphthalene-2-sulfonic acid |
| SMILES | Cc1cc(/N=N/c2c(S(=O)(=O)O)cc3ccccc3c2N)ccc1-c1ccc(/N=N/c2c(S(=O)(=O)O)cc3ccccc3c2N)cc1C |
| InChI | InChI=1S/C34H28N6O6S2/c1-19-15-23(37-39-33-29(47(41,42)43)17-21-7-3-5-9-27(21)31(33)35)11-13-25(19)26-14-12-24(16-20(26)2)38-40-34-30(48(44,45)46)18-22-8-4-6-10-28(22)32(34)36/h3-18H,35-36H2,1-2H3,(H,41,42,43)(H,44,45,46)/b39-37+,40-38+ |
| InChIKey | OXYPWGBFTLWMSM-HVMBLDELSA-N |
| XLogP | 8.77 |
| TPSA | 210.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.77 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|