C27H22N6O13S4 — CID 135977968
4-amino-3-[(5-amino-4-methyl-2-sulfophenyl)diazenyl]-5-hydroxy-6-[(1-sulfonaphthalen-2-yl)diazenyl]naphthalene-2,7-disulfonic acid (PubChem CID 135977968) has the molecular formula C27H22N6O13S4 and a molecular weight of 766.77 g/mol. Its IUPAC name is 4-amino-3-[(5-amino-4-methyl-2-sulfophenyl)diazenyl]-5-hydroxy-6-[(1-sulfonaphthalen-2-yl)diazenyl]naphthalene-2,7-disulfonic acid.
| Compound Name | 4-amino-3-[(5-amino-4-methyl-2-sulfophenyl)diazenyl]-5-hydroxy-6-[(1-sulfonaphthalen-2-yl)diazenyl]naphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 135977968 |
| Molecular Formula | C27H22N6O13S4 |
| Molecular Weight | 766.77 g/mol |
| Exact Mass | 766.01 |
| IUPAC Name | 4-amino-3-[(5-amino-4-methyl-2-sulfophenyl)diazenyl]-5-hydroxy-6-[(1-sulfonaphthalen-2-yl)diazenyl]naphthalene-2,7-disulfonic acid |
| SMILES | Cc1cc(S(=O)(=O)O)c(/N=N/c2c(S(=O)(=O)O)cc3cc(S(=O)(=O)O)c(/N=N/c4ccc5ccccc5c4S(=O)(=O)O)c(O)c3c2N)cc1N |
| InChI | InChI=1S/C27H22N6O13S4/c1-12-8-19(47(35,36)37)18(11-16(12)28)31-32-24-20(48(38,39)40)9-14-10-21(49(41,42)43)25(26(34)22(14)23(24)29)33-30-17-7-6-13-4-2-3-5-15(13)27(17)50(44,45)46/h2-11,34H,28-29H2,1H3,(H,35,36,37)(H,38,39,40)(H,41,42,43)(H,44,45,46)/b32-31+,33-30+ |
| InChIKey | FXBYYXODQGRKNS-HIPRBATPSA-N |
| XLogP | 4.99 |
| TPSA | 339.19 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.77 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|