C23H21N3O4S — CID 135714446
2-[(8-amino-1-hydroxy-3,5-dimethylnaphthalen-2-yl)diazenyl]-6-methylnaphthalene-1-sulfonic acid (PubChem CID 135714446) has the molecular formula C23H21N3O4S and a molecular weight of 435.51 g/mol. Its IUPAC name is 2-[(8-amino-1-hydroxy-3,5-dimethylnaphthalen-2-yl)diazenyl]-6-methylnaphthalene-1-sulfonic acid.
| Compound Name | 2-[(8-amino-1-hydroxy-3,5-dimethylnaphthalen-2-yl)diazenyl]-6-methylnaphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 135714446 |
| Molecular Formula | C23H21N3O4S |
| Molecular Weight | 435.51 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | 2-[(8-amino-1-hydroxy-3,5-dimethylnaphthalen-2-yl)diazenyl]-6-methylnaphthalene-1-sulfonic acid |
| SMILES | Cc1ccc2c(S(=O)(=O)O)c(/N=N/c3c(C)cc4c(C)ccc(N)c4c3O)ccc2c1 |
| InChI | InChI=1S/C23H21N3O4S/c1-12-4-7-16-15(10-12)6-9-19(23(16)31(28,29)30)25-26-21-14(3)11-17-13(2)5-8-18(24)20(17)22(21)27/h4-11,27H,24H2,1-3H3,(H,28,29,30)/b26-25+ |
| InChIKey | ZVCIKERQKIBUMZ-OCEACIFDSA-N |
| XLogP | 5.87 |
| TPSA | 125.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.51 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|