C24H24N4O7S2 — CID 136653905
2-[[8-amino-1-hydroxy-3-methyl-7-(methylideneamino)naphthalen-2-yl]diazenyl]-5-methylnaphthalene-1-sulfonic acid;methanesulfonic acid (PubChem CID 136653905) has the molecular formula C24H24N4O7S2 and a molecular weight of 544.61 g/mol. Its IUPAC name is 2-[[8-amino-1-hydroxy-3-methyl-7-(methylideneamino)naphthalen-2-yl]diazenyl]-5-methylnaphthalene-1-sulfonic acid;methanesulfonic acid.
| Compound Name | 2-[[8-amino-1-hydroxy-3-methyl-7-(methylideneamino)naphthalen-2-yl]diazenyl]-5-methylnaphthalene-1-sulfonic acid;methanesulfonic acid |
|---|---|
| PubChem CID | 136653905 |
| Molecular Formula | C24H24N4O7S2 |
| Molecular Weight | 544.61 g/mol |
| Exact Mass | 544.11 |
| IUPAC Name | 2-[[8-amino-1-hydroxy-3-methyl-7-(methylideneamino)naphthalen-2-yl]diazenyl]-5-methylnaphthalene-1-sulfonic acid;methanesulfonic acid |
| SMILES | C=Nc1ccc2cc(C)c(/N=N/c3ccc4c(C)cccc4c3S(=O)(=O)O)c(O)c2c1N.CS(=O)(=O)O |
| InChI | InChI=1S/C23H20N4O4S.CH4O3S/c1-12-5-4-6-16-15(12)8-10-18(23(16)32(29,30)31)26-27-21-13(2)11-14-7-9-17(25-3)20(24)19(14)22(21)28;1-5(2,3)4/h4-11,28H,3,24H2,1-2H3,(H,29,30,31);1H3,(H,2,3,4)/b27-26+; |
| InChIKey | GQKDHSBDKSMCIC-JGUILPGDSA-N |
| XLogP | 5.40 |
| TPSA | 192.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.61 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|