C21H16N2O13S4 — CID 135731571
2-[[1-hydroxy-8-methyl-6-sulfo-3-(trioxidanylsulfanyl)naphthalen-2-yl]diazenyl]naphthalene-1,5-disulfonic acid (PubChem CID 135731571) has the molecular formula C21H16N2O13S4 and a molecular weight of 632.63 g/mol. Its IUPAC name is 2-[[1-hydroxy-8-methyl-6-sulfo-3-(trioxidanylsulfanyl)naphthalen-2-yl]diazenyl]naphthalene-1,5-disulfonic acid.
| Compound Name | 2-[[1-hydroxy-8-methyl-6-sulfo-3-(trioxidanylsulfanyl)naphthalen-2-yl]diazenyl]naphthalene-1,5-disulfonic acid |
|---|---|
| PubChem CID | 135731571 |
| Molecular Formula | C21H16N2O13S4 |
| Molecular Weight | 632.63 g/mol |
| Exact Mass | 631.95 |
| IUPAC Name | 2-[[1-hydroxy-8-methyl-6-sulfo-3-(trioxidanylsulfanyl)naphthalen-2-yl]diazenyl]naphthalene-1,5-disulfonic acid |
| SMILES | Cc1cc(S(=O)(=O)O)cc2cc(SOOO)c(/N=N/c3ccc4c(S(=O)(=O)O)cccc4c3S(=O)(=O)O)c(O)c12 |
| InChI | InChI=1S/C21H16N2O13S4/c1-10-7-12(38(26,27)28)8-11-9-16(37-36-35-25)19(20(24)18(10)11)23-22-15-6-5-13-14(21(15)40(32,33)34)3-2-4-17(13)39(29,30)31/h2-9,24-25H,1H3,(H,26,27,28)(H,29,30,31)(H,32,33,34)/b23-22+ |
| InChIKey | ZBXFTYVHTOCNQS-GHVJWSGMSA-N |
| XLogP | 4.59 |
| TPSA | 246.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.63 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|