C17H16N4O8S2 — CID 135612229
4-amino-6-[(4-amino-2-methoxyphenyl)diazenyl]-5-hydroxy-7-(trioxidanylsulfanyl)naphthalene-2-sulfonic acid (PubChem CID 135612229) has the molecular formula C17H16N4O8S2 and a molecular weight of 468.47 g/mol. Its IUPAC name is 4-amino-6-[(4-amino-2-methoxyphenyl)diazenyl]-5-hydroxy-7-(trioxidanylsulfanyl)naphthalene-2-sulfonic acid.
| Compound Name | 4-amino-6-[(4-amino-2-methoxyphenyl)diazenyl]-5-hydroxy-7-(trioxidanylsulfanyl)naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 135612229 |
| Molecular Formula | C17H16N4O8S2 |
| Molecular Weight | 468.47 g/mol |
| Exact Mass | 468.04 |
| IUPAC Name | 4-amino-6-[(4-amino-2-methoxyphenyl)diazenyl]-5-hydroxy-7-(trioxidanylsulfanyl)naphthalene-2-sulfonic acid |
| SMILES | COc1cc(N)ccc1/N=N/c1c(SOOO)cc2cc(S(=O)(=O)O)cc(N)c2c1O |
| InChI | InChI=1S/C17H16N4O8S2/c1-27-13-6-9(18)2-3-12(13)20-21-16-14(30-29-28-23)5-8-4-10(31(24,25)26)7-11(19)15(8)17(16)22/h2-7,22-23H,18-19H2,1H3,(H,24,25,26)/b21-20+ |
| InChIKey | NOTFVSLMMBHWDD-QZQOTICOSA-N |
| XLogP | 3.81 |
| TPSA | 199.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.47 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|