C24H16F5N5O9S2 — CID 135974901
3-amino-6-[[2,5-dimethoxy-4-[(2,3,4,5,6-pentafluorophenyl)diazenyl]phenyl]diazenyl]-5-hydroxy-7-(trioxidanylsulfanyl)naphthalene-2-sulfonic acid (PubChem CID 135974901) has the molecular formula C24H16F5N5O9S2 and a molecular weight of 677.54 g/mol. Its IUPAC name is 3-amino-6-[[2,5-dimethoxy-4-[(2,3,4,5,6-pentafluorophenyl)diazenyl]phenyl]diazenyl]-5-hydroxy-7-(trioxidanylsulfanyl)naphthalene-2-sulfonic acid.
| Compound Name | 3-amino-6-[[2,5-dimethoxy-4-[(2,3,4,5,6-pentafluorophenyl)diazenyl]phenyl]diazenyl]-5-hydroxy-7-(trioxidanylsulfanyl)naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 135974901 |
| Molecular Formula | C24H16F5N5O9S2 |
| Molecular Weight | 677.54 g/mol |
| Exact Mass | 677.03 |
| IUPAC Name | 3-amino-6-[[2,5-dimethoxy-4-[(2,3,4,5,6-pentafluorophenyl)diazenyl]phenyl]diazenyl]-5-hydroxy-7-(trioxidanylsulfanyl)naphthalene-2-sulfonic acid |
| SMILES | COc1cc(/N=N/c2c(SOOO)cc3cc(S(=O)(=O)O)c(N)cc3c2O)c(OC)cc1/N=N/c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C24H16F5N5O9S2/c1-40-13-7-12(32-34-23-20(28)18(26)17(25)19(27)21(23)29)14(41-2)6-11(13)31-33-22-15(44-43-42-36)3-8-4-16(45(37,38)39)10(30)5-9(8)24(22)35/h3-7,35-36H,30H2,1-2H3,(H,37,38,39)/b33-31+,34-32+ |
| InChIKey | NQPADHUXLLAPGW-FMWAKIAMSA-N |
| XLogP | 7.35 |
| TPSA | 207.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.54 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|