C27H27N5O15S4 — CID 135978947
4-amino-6-[(2,5-dimethoxy-4-methylphenyl)diazenyl]-5-hydroxy-3-[[4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]-7-(trioxidanylsulfanyl)naphthalene-2-sulfonic acid (PubChem CID 135978947) has the molecular formula C27H27N5O15S4 and a molecular weight of 789.80 g/mol. Its IUPAC name is 4-amino-6-[(2,5-dimethoxy-4-methylphenyl)diazenyl]-5-hydroxy-3-[[4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]-7-(trioxidanylsulfanyl)naphthalene-2-sulfonic acid.
| Compound Name | 4-amino-6-[(2,5-dimethoxy-4-methylphenyl)diazenyl]-5-hydroxy-3-[[4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]-7-(trioxidanylsulfanyl)naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 135978947 |
| Molecular Formula | C27H27N5O15S4 |
| Molecular Weight | 789.80 g/mol |
| Exact Mass | 789.04 |
| IUPAC Name | 4-amino-6-[(2,5-dimethoxy-4-methylphenyl)diazenyl]-5-hydroxy-3-[[4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]-7-(trioxidanylsulfanyl)naphthalene-2-sulfonic acid |
| SMILES | COc1cc(/N=N/c2c(SOOO)cc3cc(S(=O)(=O)O)c(/N=N/c4ccc(S(=O)(=O)CCOS(=O)(=O)O)cc4)c(N)c3c2O)c(OC)cc1C |
| InChI | InChI=1S/C27H27N5O15S4/c1-14-10-20(44-3)18(13-19(14)43-2)30-31-25-21(48-47-46-34)11-15-12-22(50(37,38)39)26(24(28)23(15)27(25)33)32-29-16-4-6-17(7-5-16)49(35,36)9-8-45-51(40,41)42/h4-7,10-13,33-34H,8-9,28H2,1-3H3,(H,37,38,39)(H,40,41,42)/b31-30+,32-29+ |
| InChIKey | DMESHQCXOFKGPP-JUVFNHDTSA-N |
| XLogP | 5.55 |
| TPSA | 304.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 789.80 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|