C28H33N5O11S4 — CID 136511089
5-amino-4-hydroxy-3,6-bis[(4-methylsulfonylphenyl)diazenyl]-7-(trioxidanylsulfanyl)naphthalene-2-sulfonic acid;ethane (PubChem CID 136511089) has the molecular formula C28H33N5O11S4 and a molecular weight of 743.86 g/mol. Its IUPAC name is 5-amino-4-hydroxy-3,6-bis[(4-methylsulfonylphenyl)diazenyl]-7-(trioxidanylsulfanyl)naphthalene-2-sulfonic acid;ethane.
| Compound Name | 5-amino-4-hydroxy-3,6-bis[(4-methylsulfonylphenyl)diazenyl]-7-(trioxidanylsulfanyl)naphthalene-2-sulfonic acid;ethane |
|---|---|
| PubChem CID | 136511089 |
| Molecular Formula | C28H33N5O11S4 |
| Molecular Weight | 743.86 g/mol |
| Exact Mass | 743.11 |
| IUPAC Name | 5-amino-4-hydroxy-3,6-bis[(4-methylsulfonylphenyl)diazenyl]-7-(trioxidanylsulfanyl)naphthalene-2-sulfonic acid;ethane |
| SMILES | CC.CC.CS(=O)(=O)c1ccc(/N=N/c2c(SOOO)cc3cc(S(=O)(=O)O)c(/N=N/c4ccc(S(C)(=O)=O)cc4)c(O)c3c2N)cc1 |
| InChI | InChI=1S/C24H21N5O11S4.2C2H6/c1-42(32,33)16-7-3-14(4-8-16)26-28-22-18(41-40-39-31)11-13-12-19(44(36,37)38)23(24(30)20(13)21(22)25)29-27-15-5-9-17(10-6-15)43(2,34)35;2*1-2/h3-12,30-31H,25H2,1-2H3,(H,36,37,38);2*1-2H3/b28-26+,29-27+;; |
| InChIKey | NVGDOYCNXQDDEL-CYXDXXRZSA-N |
| XLogP | 7.49 |
| TPSA | 257.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.86 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|