C29H28N6O14S2 — CID 135597686
5-acetamido-2-[[4-[[7-amino-1-hydroxy-6-sulfo-3-(trioxidanylsulfanyl)naphthalen-2-yl]diazenyl]-2,5-bis(2-hydroxyethoxy)phenyl]diazenyl]benzoic acid (PubChem CID 135597686) has the molecular formula C29H28N6O14S2 and a molecular weight of 748.70 g/mol. Its IUPAC name is 5-acetamido-2-[[4-[[7-amino-1-hydroxy-6-sulfo-3-(trioxidanylsulfanyl)naphthalen-2-yl]diazenyl]-2,5-bis(2-hydroxyethoxy)phenyl]diazenyl]benzoic acid.
| Compound Name | 5-acetamido-2-[[4-[[7-amino-1-hydroxy-6-sulfo-3-(trioxidanylsulfanyl)naphthalen-2-yl]diazenyl]-2,5-bis(2-hydroxyethoxy)phenyl]diazenyl]benzoic acid |
|---|---|
| PubChem CID | 135597686 |
| Molecular Formula | C29H28N6O14S2 |
| Molecular Weight | 748.70 g/mol |
| Exact Mass | 748.11 |
| IUPAC Name | 5-acetamido-2-[[4-[[7-amino-1-hydroxy-6-sulfo-3-(trioxidanylsulfanyl)naphthalen-2-yl]diazenyl]-2,5-bis(2-hydroxyethoxy)phenyl]diazenyl]benzoic acid |
| SMILES | CC(=O)Nc1ccc(/N=N/c2cc(OCCO)c(/N=N/c3c(SOOO)cc4cc(S(=O)(=O)O)c(N)cc4c3O)cc2OCCO)c(C(=O)O)c1 |
| InChI | InChI=1S/C29H28N6O14S2/c1-14(38)31-16-2-3-20(18(10-16)29(40)41)32-33-21-12-24(47-7-5-37)22(13-23(21)46-6-4-36)34-35-27-25(50-49-48-42)8-15-9-26(51(43,44)45)19(30)11-17(15)28(27)39/h2-3,8-13,36-37,39,42H,4-7,30H2,1H3,(H,31,38)(H,40,41)(H,43,44,45)/b33-32+,35-34+ |
| InChIKey | GREMLSPTRAQZCB-VPHDGDOJSA-N |
| XLogP | 5.03 |
| TPSA | 314.07 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.70 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|