C27H28N6O14S3 — CID 142060502
2-amino-5-[[2,5-bis(2-hydroxyethoxy)-4-[[1-hydroxy-7-(methylamino)-3-sulfonaphthalen-2-yl]diazenyl]phenyl]diazenyl]benzene-1,4-disulfonic acid (PubChem CID 142060502) has the molecular formula C27H28N6O14S3 and a molecular weight of 756.75 g/mol. Its IUPAC name is 2-amino-5-[[2,5-bis(2-hydroxyethoxy)-4-[[1-hydroxy-7-(methylamino)-3-sulfonaphthalen-2-yl]diazenyl]phenyl]diazenyl]benzene-1,4-disulfonic acid.
| Compound Name | 2-amino-5-[[2,5-bis(2-hydroxyethoxy)-4-[[1-hydroxy-7-(methylamino)-3-sulfonaphthalen-2-yl]diazenyl]phenyl]diazenyl]benzene-1,4-disulfonic acid |
|---|---|
| PubChem CID | 142060502 |
| Molecular Formula | C27H28N6O14S3 |
| Molecular Weight | 756.75 g/mol |
| Exact Mass | 756.08 |
| IUPAC Name | 2-amino-5-[[2,5-bis(2-hydroxyethoxy)-4-[[1-hydroxy-7-(methylamino)-3-sulfonaphthalen-2-yl]diazenyl]phenyl]diazenyl]benzene-1,4-disulfonic acid |
| SMILES | CNc1ccc2cc(S(=O)(=O)O)c(/N=N/c3cc(OCCO)c(/N=N/c4cc(S(=O)(=O)O)c(N)cc4S(=O)(=O)O)cc3OCCO)c(O)c2c1 |
| InChI | InChI=1S/C27H28N6O14S3/c1-29-15-3-2-14-8-25(50(43,44)45)26(27(36)16(14)9-15)33-31-19-12-21(46-6-4-34)18(11-22(19)47-7-5-35)30-32-20-13-23(48(37,38)39)17(28)10-24(20)49(40,41)42/h2-3,8-13,29,34-36H,4-7,28H2,1H3,(H,37,38,39)(H,40,41,42)(H,43,44,45)/b32-30+,33-31+ |
| InChIKey | YCJFIKGCABGABW-RRPBDJRISA-N |
| XLogP | 3.48 |
| TPSA | 329.75 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.75 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|