C29H25N5O13S3 — CID 145275973
6-amino-3-[[2-(1,2-dihydroxyethoxy)-5-methyl-4-[(7-sulfonaphthalen-1-yl)diazenyl]phenyl]diazenyl]-4-hydroxynaphthalene-2,7-disulfonic acid (PubChem CID 145275973) has the molecular formula C29H25N5O13S3 and a molecular weight of 747.74 g/mol. Its IUPAC name is 6-amino-3-[[2-(1,2-dihydroxyethoxy)-5-methyl-4-[(7-sulfonaphthalen-1-yl)diazenyl]phenyl]diazenyl]-4-hydroxynaphthalene-2,7-disulfonic acid.
| Compound Name | 6-amino-3-[[2-(1,2-dihydroxyethoxy)-5-methyl-4-[(7-sulfonaphthalen-1-yl)diazenyl]phenyl]diazenyl]-4-hydroxynaphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 145275973 |
| Molecular Formula | C29H25N5O13S3 |
| Molecular Weight | 747.74 g/mol |
| Exact Mass | 747.06 |
| IUPAC Name | 6-amino-3-[[2-(1,2-dihydroxyethoxy)-5-methyl-4-[(7-sulfonaphthalen-1-yl)diazenyl]phenyl]diazenyl]-4-hydroxynaphthalene-2,7-disulfonic acid |
| SMILES | Cc1cc(/N=N/c2c(S(=O)(=O)O)cc3cc(S(=O)(=O)O)c(N)cc3c2O)c(OC(O)CO)cc1/N=N/c1cccc2ccc(S(=O)(=O)O)cc12 |
| InChI | InChI=1S/C29H25N5O13S3/c1-14-7-23(33-34-28-26(50(44,45)46)9-16-8-25(49(41,42)43)20(30)11-19(16)29(28)37)24(47-27(36)13-35)12-22(14)32-31-21-4-2-3-15-5-6-17(10-18(15)21)48(38,39)40/h2-12,27,35-37H,13,30H2,1H3,(H,38,39,40)(H,41,42,43)(H,44,45,46)/b32-31+,34-33+ |
| InChIKey | VFIYNQUOVCMZST-HSBKYFPUSA-N |
| XLogP | 4.85 |
| TPSA | 308.49 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.74 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|