C27H24N6O10S2 — CID 135962583
3-amino-6-[[2-(2,3-dihydroxypropoxy)-4-[(3-isocyanophenyl)diazenyl]-5-methylphenyl]diazenyl]-5-hydroxy-7-(trioxidanylsulfanyl)naphthalene-2-sulfonic acid (PubChem CID 135962583) has the molecular formula C27H24N6O10S2 and a molecular weight of 656.66 g/mol. Its IUPAC name is 3-amino-6-[[2-(2,3-dihydroxypropoxy)-4-[(3-isocyanophenyl)diazenyl]-5-methylphenyl]diazenyl]-5-hydroxy-7-(trioxidanylsulfanyl)naphthalene-2-sulfonic acid.
| Compound Name | 3-amino-6-[[2-(2,3-dihydroxypropoxy)-4-[(3-isocyanophenyl)diazenyl]-5-methylphenyl]diazenyl]-5-hydroxy-7-(trioxidanylsulfanyl)naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 135962583 |
| Molecular Formula | C27H24N6O10S2 |
| Molecular Weight | 656.66 g/mol |
| Exact Mass | 656.10 |
| IUPAC Name | 3-amino-6-[[2-(2,3-dihydroxypropoxy)-4-[(3-isocyanophenyl)diazenyl]-5-methylphenyl]diazenyl]-5-hydroxy-7-(trioxidanylsulfanyl)naphthalene-2-sulfonic acid |
| SMILES | [C-]#[N+]c1cccc(/N=N/c2cc(OCC(O)CO)c(/N=N/c3c(SOOO)cc4cc(S(=O)(=O)O)c(N)cc4c3O)cc2C)c1 |
| InChI | InChI=1S/C27H24N6O10S2/c1-14-6-22(23(41-13-18(35)12-34)11-21(14)31-30-17-5-3-4-16(9-17)29-2)32-33-26-24(44-43-42-37)7-15-8-25(45(38,39)40)20(28)10-19(15)27(26)36/h3-11,18,34-37H,12-13,28H2,1H3,(H,38,39,40)/b31-30+,33-32+ |
| InChIKey | QKBMWCNXZLCLPE-CJQWSLHQSA-N |
| XLogP | 6.22 |
| TPSA | 242.80 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.66 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|