C33H33N5O13S3 — CID 137006758
3-[[4-[(6-amino-1-hydroxy-3-sulfonaphthalen-2-yl)diazenyl]-5-[2-(2-hydroxypropoxy)propoxy]-2-methylphenyl]diazenyl]naphthalene-1,5-disulfonic acid (PubChem CID 137006758) has the molecular formula C33H33N5O13S3 and a molecular weight of 803.85 g/mol. Its IUPAC name is 3-[[4-[(6-amino-1-hydroxy-3-sulfonaphthalen-2-yl)diazenyl]-5-[2-(2-hydroxypropoxy)propoxy]-2-methylphenyl]diazenyl]naphthalene-1,5-disulfonic acid.
| Compound Name | 3-[[4-[(6-amino-1-hydroxy-3-sulfonaphthalen-2-yl)diazenyl]-5-[2-(2-hydroxypropoxy)propoxy]-2-methylphenyl]diazenyl]naphthalene-1,5-disulfonic acid |
|---|---|
| PubChem CID | 137006758 |
| Molecular Formula | C33H33N5O13S3 |
| Molecular Weight | 803.85 g/mol |
| Exact Mass | 803.12 |
| IUPAC Name | 3-[[4-[(6-amino-1-hydroxy-3-sulfonaphthalen-2-yl)diazenyl]-5-[2-(2-hydroxypropoxy)propoxy]-2-methylphenyl]diazenyl]naphthalene-1,5-disulfonic acid |
| SMILES | Cc1cc(/N=N/c2c(S(=O)(=O)O)cc3cc(N)ccc3c2O)c(OCC(C)OCC(C)O)cc1/N=N/c1cc(S(=O)(=O)O)c2cccc(S(=O)(=O)O)c2c1 |
| InChI | InChI=1S/C33H33N5O13S3/c1-17-9-27(37-38-32-31(54(47,48)49)11-20-10-21(34)7-8-23(20)33(32)40)28(51-16-19(3)50-15-18(2)39)14-26(17)36-35-22-12-25-24(30(13-22)53(44,45)46)5-4-6-29(25)52(41,42)43/h4-14,18-19,39-40H,15-16,34H2,1-3H3,(H,41,42,43)(H,44,45,46)(H,47,48,49)/b36-35+,38-37+ |
| InChIKey | ONQCCVYVZRGJEL-JKWOPUAESA-N |
| XLogP | 6.32 |
| TPSA | 297.49 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 54 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 803.85 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|