C34H27N5NaO10S2+ — CID 135422070
sodium 7-amino-4-hydroxy-3-[[4-[4-[(1-hydroxy-4-sulfonaphthalen-2-yl)diazenyl]-3-methoxyphenyl]-2-methoxyphenyl]diazenyl]naphthalene-2-sulfonic acid (PubChem CID 135422070) has the molecular formula C34H27N5NaO10S2+ and a molecular weight of 752.74 g/mol. Its IUPAC name is sodium 7-amino-4-hydroxy-3-[[4-[4-[(1-hydroxy-4-sulfonaphthalen-2-yl)diazenyl]-3-methoxyphenyl]-2-methoxyphenyl]diazenyl]naphthalene-2-sulfonic acid.
| Compound Name | sodium 7-amino-4-hydroxy-3-[[4-[4-[(1-hydroxy-4-sulfonaphthalen-2-yl)diazenyl]-3-methoxyphenyl]-2-methoxyphenyl]diazenyl]naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 135422070 |
| Molecular Formula | C34H27N5NaO10S2+ |
| Molecular Weight | 752.74 g/mol |
| Exact Mass | 752.11 |
| IUPAC Name | sodium 7-amino-4-hydroxy-3-[[4-[4-[(1-hydroxy-4-sulfonaphthalen-2-yl)diazenyl]-3-methoxyphenyl]-2-methoxyphenyl]diazenyl]naphthalene-2-sulfonic acid |
| SMILES | COc1cc(-c2ccc(/N=N/c3c(S(=O)(=O)O)cc4cc(N)ccc4c3O)c(OC)c2)ccc1/N=N/c1cc(S(=O)(=O)O)c2ccccc2c1O.[Na+] |
| InChI | InChI=1S/C34H27N5O10S2.Na/c1-48-28-14-18(7-11-25(28)36-38-27-17-30(50(42,43)44)23-5-3-4-6-24(23)33(27)40)19-8-12-26(29(15-19)49-2)37-39-32-31(51(45,46)47)16-20-13-21(35)9-10-22(20)34(32)41;/h3-17,40-41H,35H2,1-2H3,(H,42,43,44)(H,45,46,47);/q;+1/b38-36+,39-37+; |
| InChIKey | IPDNIRMEXLMZEL-UPLBNUMFSA-N |
| XLogP | 5.00 |
| TPSA | 243.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.74 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|