C34H25N5Na2O10S2 — CID 165363118
disodium;7-amino-4-hydroxy-3-[[4-[4-[(1-hydroxy-5-sulfonatonaphthalen-2-yl)diazenyl]-3-methoxyphenyl]-2-methoxyphenyl]diazenyl]naphthalene-2-sulfonate (PubChem CID 165363118) has the molecular formula C34H25N5Na2O10S2 and a molecular weight of 773.71 g/mol. Its IUPAC name is disodium;7-amino-4-hydroxy-3-[[4-[4-[(1-hydroxy-5-sulfonatonaphthalen-2-yl)diazenyl]-3-methoxyphenyl]-2-methoxyphenyl]diazenyl]naphthalene-2-sulfonate.
| Compound Name | disodium;7-amino-4-hydroxy-3-[[4-[4-[(1-hydroxy-5-sulfonatonaphthalen-2-yl)diazenyl]-3-methoxyphenyl]-2-methoxyphenyl]diazenyl]naphthalene-2-sulfonate |
|---|---|
| PubChem CID | 165363118 |
| Molecular Formula | C34H25N5Na2O10S2 |
| Molecular Weight | 773.71 g/mol |
| Exact Mass | 773.08 |
| IUPAC Name | disodium;7-amino-4-hydroxy-3-[[4-[4-[(1-hydroxy-5-sulfonatonaphthalen-2-yl)diazenyl]-3-methoxyphenyl]-2-methoxyphenyl]diazenyl]naphthalene-2-sulfonate |
| SMILES | COc1cc(-c2ccc(/N=N/c3c(S(=O)(=O)[O-])cc4cc(N)ccc4c3O)c(OC)c2)ccc1/N=N/c1ccc2c(S(=O)(=O)[O-])cccc2c1O.[Na+].[Na+] |
| InChI | InChI=1S/C34H27N5O10S2.2Na/c1-48-28-15-18(6-11-25(28)36-38-27-13-10-23-24(33(27)40)4-3-5-30(23)50(42,43)44)19-7-12-26(29(16-19)49-2)37-39-32-31(51(45,46)47)17-20-14-21(35)8-9-22(20)34(32)41;;/h3-17,40-41H,35H2,1-2H3,(H,42,43,44)(H,45,46,47);;/q;2*+1/p-2/b38-36+,39-37+;; |
| InChIKey | SGOBYEXEDDQAAM-PYIFGEPISA-L |
| XLogP | 1.32 |
| TPSA | 248.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 773.71 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|