C27H19N5O13S3 — CID 135962525
5-[[4-[[7-amino-1-hydroxy-6-sulfo-3-(trioxidanylsulfanyl)naphthalen-2-yl]diazenyl]-6-sulfonaphthalen-1-yl]diazenyl]-2-hydroxybenzoic acid (PubChem CID 135962525) has the molecular formula C27H19N5O13S3 and a molecular weight of 717.67 g/mol. Its IUPAC name is 5-[[4-[[7-amino-1-hydroxy-6-sulfo-3-(trioxidanylsulfanyl)naphthalen-2-yl]diazenyl]-6-sulfonaphthalen-1-yl]diazenyl]-2-hydroxybenzoic acid.
| Compound Name | 5-[[4-[[7-amino-1-hydroxy-6-sulfo-3-(trioxidanylsulfanyl)naphthalen-2-yl]diazenyl]-6-sulfonaphthalen-1-yl]diazenyl]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 135962525 |
| Molecular Formula | C27H19N5O13S3 |
| Molecular Weight | 717.67 g/mol |
| Exact Mass | 717.01 |
| IUPAC Name | 5-[[4-[[7-amino-1-hydroxy-6-sulfo-3-(trioxidanylsulfanyl)naphthalen-2-yl]diazenyl]-6-sulfonaphthalen-1-yl]diazenyl]-2-hydroxybenzoic acid |
| SMILES | Nc1cc2c(O)c(/N=N/c3ccc(/N=N/c4ccc(O)c(C(=O)O)c4)c4ccc(S(=O)(=O)O)cc34)c(SOOO)cc2cc1S(=O)(=O)O |
| InChI | InChI=1S/C27H19N5O13S3/c28-19-11-16-12(8-24(19)48(41,42)43)7-23(46-45-44-37)25(26(16)34)32-31-21-5-4-20(15-3-2-14(10-17(15)21)47(38,39)40)30-29-13-1-6-22(33)18(9-13)27(35)36/h1-11,33-34,37H,28H2,(H,35,36)(H,38,39,40)(H,41,42,43)/b30-29+,32-31+ |
| InChIKey | DIVKMCLUZCOJKZ-PNBBGTCESA-N |
| XLogP | 6.44 |
| TPSA | 300.65 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.67 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|