C22H16N4O13S4 — CID 135992914
5-hydroxy-6-[[2-sulfo-4-[[4-(trioxidanylsulfanyl)phenyl]diazenyl]phenyl]diazenyl]-7-(trioxidanylsulfanyl)naphthalene-2-sulfonic acid (PubChem CID 135992914) has the molecular formula C22H16N4O13S4 and a molecular weight of 672.65 g/mol. Its IUPAC name is 5-hydroxy-6-[[2-sulfo-4-[[4-(trioxidanylsulfanyl)phenyl]diazenyl]phenyl]diazenyl]-7-(trioxidanylsulfanyl)naphthalene-2-sulfonic acid.
| Compound Name | 5-hydroxy-6-[[2-sulfo-4-[[4-(trioxidanylsulfanyl)phenyl]diazenyl]phenyl]diazenyl]-7-(trioxidanylsulfanyl)naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 135992914 |
| Molecular Formula | C22H16N4O13S4 |
| Molecular Weight | 672.65 g/mol |
| Exact Mass | 671.96 |
| IUPAC Name | 5-hydroxy-6-[[2-sulfo-4-[[4-(trioxidanylsulfanyl)phenyl]diazenyl]phenyl]diazenyl]-7-(trioxidanylsulfanyl)naphthalene-2-sulfonic acid |
| SMILES | O=S(=O)(O)c1ccc2c(O)c(/N=N/c3ccc(/N=N/c4ccc(SOOO)cc4)cc3S(=O)(=O)O)c(SOOO)cc2c1 |
| InChI | InChI=1S/C22H16N4O13S4/c27-22-17-7-6-16(42(30,31)32)9-12(17)10-19(41-39-37-29)21(22)26-25-18-8-3-14(11-20(18)43(33,34)35)24-23-13-1-4-15(5-2-13)40-38-36-28/h1-11,27-29H,(H,30,31,32)(H,33,34,35)/b24-23+,26-25+ |
| InChIKey | KEDQUMWCDYIXHJ-QSZPNPOGSA-N |
| XLogP | 6.73 |
| TPSA | 255.79 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.65 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|