C24H21N5O9S2 — CID 135992795
2-[[2-hydroxy-5-methoxy-4-[[4-(trioxidanylsulfanyl)phenyl]diazenyl]phenyl]diazenyl]-6-(methylamino)-3-(trioxidanylsulfanyl)naphthalen-1-ol (PubChem CID 135992795) has the molecular formula C24H21N5O9S2 and a molecular weight of 587.59 g/mol. Its IUPAC name is 2-[[2-hydroxy-5-methoxy-4-[[4-(trioxidanylsulfanyl)phenyl]diazenyl]phenyl]diazenyl]-6-(methylamino)-3-(trioxidanylsulfanyl)naphthalen-1-ol.
| Compound Name | 2-[[2-hydroxy-5-methoxy-4-[[4-(trioxidanylsulfanyl)phenyl]diazenyl]phenyl]diazenyl]-6-(methylamino)-3-(trioxidanylsulfanyl)naphthalen-1-ol |
|---|---|
| PubChem CID | 135992795 |
| Molecular Formula | C24H21N5O9S2 |
| Molecular Weight | 587.59 g/mol |
| Exact Mass | 587.08 |
| IUPAC Name | 2-[[2-hydroxy-5-methoxy-4-[[4-(trioxidanylsulfanyl)phenyl]diazenyl]phenyl]diazenyl]-6-(methylamino)-3-(trioxidanylsulfanyl)naphthalen-1-ol |
| SMILES | CNc1ccc2c(O)c(/N=N/c3cc(OC)c(/N=N/c4ccc(SOOO)cc4)cc3O)c(SOOO)cc2c1 |
| InChI | InChI=1S/C24H21N5O9S2/c1-25-15-5-8-17-13(9-15)10-22(40-38-36-33)23(24(17)31)29-27-18-12-21(34-2)19(11-20(18)30)28-26-14-3-6-16(7-4-14)39-37-35-32/h3-12,25,30-33H,1-2H3/b28-26+,29-27+ |
| InChIKey | FHLHXWITXXDMEE-TUUFZWAFSA-N |
| XLogP | 7.99 |
| TPSA | 188.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.59 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|