C20H14Cl2N6O4S — CID 135978946
6-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-2-[(4-methylphenyl)diazenyl]-3-(trioxidanylsulfanyl)naphthalen-1-ol (PubChem CID 135978946) has the molecular formula C20H14Cl2N6O4S and a molecular weight of 505.34 g/mol. Its IUPAC name is 6-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-2-[(4-methylphenyl)diazenyl]-3-(trioxidanylsulfanyl)naphthalen-1-ol.
| Compound Name | 6-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-2-[(4-methylphenyl)diazenyl]-3-(trioxidanylsulfanyl)naphthalen-1-ol |
|---|---|
| PubChem CID | 135978946 |
| Molecular Formula | C20H14Cl2N6O4S |
| Molecular Weight | 505.34 g/mol |
| Exact Mass | 504.02 |
| IUPAC Name | 6-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-2-[(4-methylphenyl)diazenyl]-3-(trioxidanylsulfanyl)naphthalen-1-ol |
| SMILES | Cc1ccc(/N=N/c2c(SOOO)cc3cc(Nc4nc(Cl)nc(Cl)n4)ccc3c2O)cc1 |
| InChI | InChI=1S/C20H14Cl2N6O4S/c1-10-2-4-12(5-3-10)27-28-16-15(33-32-31-30)9-11-8-13(6-7-14(11)17(16)29)23-20-25-18(21)24-19(22)26-20/h2-9,29-30H,1H3,(H,23,24,25,26)/b28-27+ |
| InChIKey | VWGQNROFNROCPB-BYYHNAKLSA-N |
| XLogP | 6.93 |
| TPSA | 134.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.34 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|