C37H29N7O8S2 — CID 135978892
N-[6-[[2,5-dimethyl-4-[[4-[[4-(trioxidanylsulfanyl)phenyl]diazenyl]phenyl]diazenyl]phenyl]diazenyl]-5-hydroxy-7-(trioxidanylsulfanyl)naphthalen-2-yl]benzamide (PubChem CID 135978892) has the molecular formula C37H29N7O8S2 and a molecular weight of 763.81 g/mol. Its IUPAC name is N-[6-[[2,5-dimethyl-4-[[4-[[4-(trioxidanylsulfanyl)phenyl]diazenyl]phenyl]diazenyl]phenyl]diazenyl]-5-hydroxy-7-(trioxidanylsulfanyl)naphthalen-2-yl]benzamide.
| Compound Name | N-[6-[[2,5-dimethyl-4-[[4-[[4-(trioxidanylsulfanyl)phenyl]diazenyl]phenyl]diazenyl]phenyl]diazenyl]-5-hydroxy-7-(trioxidanylsulfanyl)naphthalen-2-yl]benzamide |
|---|---|
| PubChem CID | 135978892 |
| Molecular Formula | C37H29N7O8S2 |
| Molecular Weight | 763.81 g/mol |
| Exact Mass | 763.15 |
| IUPAC Name | N-[6-[[2,5-dimethyl-4-[[4-[[4-(trioxidanylsulfanyl)phenyl]diazenyl]phenyl]diazenyl]phenyl]diazenyl]-5-hydroxy-7-(trioxidanylsulfanyl)naphthalen-2-yl]benzamide |
| SMILES | Cc1cc(/N=N/c2c(SOOO)cc3cc(NC(=O)c4ccccc4)ccc3c2O)c(C)cc1/N=N/c1ccc(/N=N/c2ccc(SOOO)cc2)cc1 |
| InChI | InChI=1S/C37H29N7O8S2/c1-22-19-33(23(2)18-32(22)42-41-27-10-8-26(9-11-27)39-40-28-12-15-30(16-13-28)53-51-49-47)43-44-35-34(54-52-50-48)21-25-20-29(14-17-31(25)36(35)45)38-37(46)24-6-4-3-5-7-24/h3-21,45,47-48H,1-2H3,(H,38,46)/b40-39+,42-41+,44-43+ |
| InChIKey | JUCWMMBTLOXUJW-MFHZMZLOSA-N |
| XLogP | 12.52 |
| TPSA | 200.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 763.81 |
| LogP ≤ 5 | 12.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|