C31H26N6O10S2 — CID 135992783
4-amino-N-[5-hydroxy-6-[[2-hydroxy-4-[[2-methoxy-5-(trioxidanylsulfanyl)phenyl]diazenyl]-5-methylphenyl]diazenyl]-7-(trioxidanylsulfanyl)naphthalen-2-yl]benzamide (PubChem CID 135992783) has the molecular formula C31H26N6O10S2 and a molecular weight of 706.72 g/mol. Its IUPAC name is 4-amino-N-[5-hydroxy-6-[[2-hydroxy-4-[[2-methoxy-5-(trioxidanylsulfanyl)phenyl]diazenyl]-5-methylphenyl]diazenyl]-7-(trioxidanylsulfanyl)naphthalen-2-yl]benzamide.
| Compound Name | 4-amino-N-[5-hydroxy-6-[[2-hydroxy-4-[[2-methoxy-5-(trioxidanylsulfanyl)phenyl]diazenyl]-5-methylphenyl]diazenyl]-7-(trioxidanylsulfanyl)naphthalen-2-yl]benzamide |
|---|---|
| PubChem CID | 135992783 |
| Molecular Formula | C31H26N6O10S2 |
| Molecular Weight | 706.72 g/mol |
| Exact Mass | 706.12 |
| IUPAC Name | 4-amino-N-[5-hydroxy-6-[[2-hydroxy-4-[[2-methoxy-5-(trioxidanylsulfanyl)phenyl]diazenyl]-5-methylphenyl]diazenyl]-7-(trioxidanylsulfanyl)naphthalen-2-yl]benzamide |
| SMILES | COc1ccc(SOOO)cc1/N=N/c1cc(O)c(/N=N/c2c(SOOO)cc3cc(NC(=O)c4ccc(N)cc4)ccc3c2O)cc1C |
| InChI | InChI=1S/C31H26N6O10S2/c1-16-11-24(26(38)15-23(16)34-36-25-14-21(48-46-44-41)8-10-27(25)43-2)35-37-29-28(49-47-45-42)13-18-12-20(7-9-22(18)30(29)39)33-31(40)17-3-5-19(32)6-4-17/h3-15,38-39,41-42H,32H2,1-2H3,(H,33,40)/b36-34+,37-35+ |
| InChIKey | NTDGGOSTFMOWEO-VHJMTFITSA-N |
| XLogP | 9.09 |
| TPSA | 231.63 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.72 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|